About 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol
1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol (PubChem CID 166572690) has the molecular formula C10H14F3NO
and a molecular weight of 221.22 g/mol. Its IUPAC name is 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol.
Molecular Properties
| Compound Name | 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol |
| PubChem CID | 166572690 |
| Molecular Formula | C10H14F3NO |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol |
| SMILES | CC(C)(C)n1ccc(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C10H14F3NO/c1-9(2,3)14-5-4-7(6-14)8(15)10(11,12)13/h4-6,8,15H,1-3H3 |
| InChIKey | ZLMXDMBCWXBZGB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol?
The IUPAC name of 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol (CID 166572690) is 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol.
What is the SMILES notation for 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol?
The canonical SMILES for 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol is CC(C)(C)n1ccc(C(O)C(F)(F)F)c1.
What is the InChIKey of 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol?
The InChIKey is ZLMXDMBCWXBZGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO/c1-9(2,3)14-5-4-7(6-14)8(15)10(11,12)13/h4-6,8,15H,1-3H3.
What are the key properties of 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol?
1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol has a molecular weight of 221.22 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-tert-butylpyrrol-3-yl)-2,2,2-trifluoroethanol is sourced from PubChem (CID 166572690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).