C24H30ClFN2O3 — CID 16657397
3-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-fluorophenyl]propanoic acid (PubChem CID 16657397) has the molecular formula C24H30ClFN2O3 and a molecular weight of 448.97 g/mol. Its IUPAC name is 3-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-fluorophenyl]propanoic acid.
| Compound Name | 3-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-fluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 16657397 |
| Molecular Formula | C24H30ClFN2O3 |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 3-[2-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]propoxy]-4-fluorophenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(F)cc1OCCCNC1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H30ClFN2O3/c25-20-6-2-18(3-7-20)17-28-13-10-22(11-14-28)27-12-1-15-31-23-16-21(26)8-4-19(23)5-9-24(29)30/h2-4,6-8,16,22,27H,1,5,9-15,17H2,(H,29,30) |
| InChIKey | KCTCUBOAXUFLKP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|