C44H36GeIrN2S-2 — CID 166575203
iridium;4-methyl-5-phenyl-2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 166575203) has the molecular formula C44H36GeIrN2S-2 and a molecular weight of 889.68 g/mol. Its IUPAC name is iridium;4-methyl-5-phenyl-2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;4-methyl-5-phenyl-2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166575203 |
| Molecular Formula | C44H36GeIrN2S-2 |
| Molecular Weight | 889.68 g/mol |
| Exact Mass | 891.15 |
| IUPAC Name | iridium;4-methyl-5-phenyl-2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.Cc1cc(-c2[c-]ccc3c2sc2ccc(-c4ccccc4)cc23)ncc1-c1ccccc1.[Ir] |
| InChI | InChI=1S/C30H20NS.C14H16GeN.Ir/c1-20-17-28(31-19-27(20)22-11-6-3-7-12-22)25-14-8-13-24-26-18-23(21-9-4-2-5-10-21)15-16-29(26)32-30(24)25;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h2-13,15-19H,1H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | KRBPNSXPEPWZJJ-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.68 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|