C46H47FIrN2OSi-2 — CID 166575327
2-[7-(3-fluorophenyl)-3H-dibenzofuran-3-id-4-yl]-4-pentan-3-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane (PubChem CID 166575327) has the molecular formula C46H47FIrN2OSi-2 and a molecular weight of 883.20 g/mol. Its IUPAC name is 2-[7-(3-fluorophenyl)-3H-dibenzofuran-3-id-4-yl]-4-pentan-3-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane.
| Compound Name | 2-[7-(3-fluorophenyl)-3H-dibenzofuran-3-id-4-yl]-4-pentan-3-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
|---|---|
| PubChem CID | 166575327 |
| Molecular Formula | C46H47FIrN2OSi-2 |
| Molecular Weight | 883.20 g/mol |
| Exact Mass | 883.31 |
| IUPAC Name | 2-[7-(3-fluorophenyl)-3H-dibenzofuran-3-id-4-yl]-4-pentan-3-ylpyridine;iridium;trimethyl-[4-(2-methylpropyl)-6-phenyl-3-pyridinyl]silane |
| SMILES | CC(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.CCC(CC)c1ccnc(-c2[c-]ccc3c2oc2cc(-c4cccc(F)c4)ccc23)c1.[Ir] |
| InChI | InChI=1S/C28H23FNO.C18H24NSi.Ir/c1-3-18(4-2)21-13-14-30-26(16-21)25-10-6-9-24-23-12-11-20(17-27(23)31-28(24)25)19-7-5-8-22(29)15-19;1-14(2)11-16-12-17(15-9-7-6-8-10-15)19-13-18(16)20(3,4)5;/h5-9,11-18H,3-4H2,1-2H3;6-9,12-14H,11H2,1-5H3;/q2*-1; |
| InChIKey | WPNCHUSUVCGCFR-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.20 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|