C25H37NSi — CID 166575435
[4-(cyclohexylmethyl)-1-methylidene-6-(2,4,6-trimethylphenyl)pyridin-1-ium-6-id-3-yl]-trimethylsilane (PubChem CID 166575435) has the molecular formula C25H37NSi and a molecular weight of 379.66 g/mol. Its IUPAC name is [4-(cyclohexylmethyl)-1-methylidene-6-(2,4,6-trimethylphenyl)pyridin-1-ium-6-id-3-yl]-trimethylsilane.
| Compound Name | [4-(cyclohexylmethyl)-1-methylidene-6-(2,4,6-trimethylphenyl)pyridin-1-ium-6-id-3-yl]-trimethylsilane |
|---|---|
| PubChem CID | 166575435 |
| Molecular Formula | C25H37NSi |
| Molecular Weight | 379.66 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | [4-(cyclohexylmethyl)-1-methylidene-6-(2,4,6-trimethylphenyl)pyridin-1-ium-6-id-3-yl]-trimethylsilane |
| SMILES | C=[N+]1C=C([Si](C)(C)C)C(CC2CCCCC2)=C[C-]1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H37NSi/c1-18-13-19(2)25(20(3)14-18)23-16-22(15-21-11-9-8-10-12-21)24(17-26(23)4)27(5,6)7/h13-14,16-17,21H,4,8-12,15H2,1-3,5-7H3 |
| InChIKey | YFDGLERXCJDKHP-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.66 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|