C42H39FIrN2SSi-2 — CID 166575759
4-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-(4-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 166575759) has the molecular formula C42H39FIrN2SSi-2 and a molecular weight of 845.17 g/mol. Its IUPAC name is 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-(4-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-(4-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166575759 |
| Molecular Formula | C42H39FIrN2SSi-2 |
| Molecular Weight | 845.17 g/mol |
| Exact Mass | 845.24 |
| IUPAC Name | 4-(1,1-dideuterio-2,2-dimethylpropyl)-2-[7-(4-fluorophenyl)-3H-dibenzothiophen-3-id-4-yl]pyridine;iridium;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])(c1ccnc(-c2[c-]ccc3c2sc2cc(-c4ccc(F)cc4)ccc23)c1)C(C)(C)C.[Ir] |
| InChI | InChI=1S/C28H23FNS.C14H16NSi.Ir/c1-28(2,3)17-18-13-14-30-25(15-18)24-6-4-5-23-22-12-9-20(16-26(22)31-27(23)24)19-7-10-21(29)11-8-19;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h4-5,7-16H,17H2,1-3H3;4-7,9-11H,1-3H3;/q2*-1;/i17D2;; |
| InChIKey | VAIUJBYNPYPFNQ-MXXAFVANSA-N |
| XLogP | 11.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.17 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|