C40H36IrN2SSi-2 — CID 166577806
iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 166577806) has the molecular formula C40H36IrN2SSi-2 and a molecular weight of 797.11 g/mol. Its IUPAC name is iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166577806 |
| Molecular Formula | C40H36IrN2SSi-2 |
| Molecular Weight | 797.11 g/mol |
| Exact Mass | 797.20 |
| IUPAC Name | iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-2-yl)-4-propan-2-ylpyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | CC(C)c1ccnc(-c2[c-]cc3sc4ccc(-c5ccccc5)cc4c3c2)c1.C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir] |
| InChI | InChI=1S/C26H20NS.C14H16NSi.Ir/c1-17(2)19-12-13-27-24(16-19)21-9-11-26-23(15-21)22-14-20(8-10-25(22)28-26)18-6-4-3-5-7-18;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h3-8,10-17H,1-2H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | PMSRVFOUWVDGPV-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.11 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|