C27H29ClFNO5S — CID 16657816
[(7R,9R,13R,16R)-9-ethenyl-7-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate (PubChem CID 16657816) has the molecular formula C27H29ClFNO5S and a molecular weight of 534.05 g/mol. Its IUPAC name is [(7R,9R,13R,16R)-9-ethenyl-7-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate.
| Compound Name | [(7R,9R,13R,16R)-9-ethenyl-7-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16657816 |
| Molecular Formula | C27H29ClFNO5S |
| Molecular Weight | 534.05 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [(7R,9R,13R,16R)-9-ethenyl-7-fluoro-3-hydroxy-13-methyl-7,8,11,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthren-16-yl] 2-chloro-5-sulfamoylbenzoate |
| SMILES | C=C[C@]12CC[C@]3(C)C[C@H](OC(=O)c4cc(S(N)(=O)=O)ccc4Cl)CC3C1C(F)Cc1cc(O)ccc12 |
| InChI | InChI=1S/C27H29ClFNO5S/c1-3-27-9-8-26(2)14-17(35-25(32)19-13-18(36(30,33)34)5-7-22(19)28)12-21(26)24(27)23(29)11-15-10-16(31)4-6-20(15)27/h3-7,10,13,17,21,23-24,31H,1,8-9,11-12,14H2,2H3,(H2,30,33,34)/t17-,21?,23?,24?,26-,27-/m1/s1 |
| InChIKey | IRKFEZJINXSMPG-MQMCJYDNSA-N |
| XLogP | 5.06 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.05 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|