C46H48IrN2SSi-2 — CID 166578504
4-(2,2-dimethylpropyl)-2-(8-methyl-6-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane (PubChem CID 166578504) has the molecular formula C46H48IrN2SSi-2 and a molecular weight of 881.27 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-2-(8-methyl-6-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane.
| Compound Name | 4-(2,2-dimethylpropyl)-2-(8-methyl-6-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 166578504 |
| Molecular Formula | C46H48IrN2SSi-2 |
| Molecular Weight | 881.27 g/mol |
| Exact Mass | 881.29 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-2-(8-methyl-6-phenyl-3H-dibenzothiophen-3-id-2-yl)pyridine;iridium;trimethyl-(6-phenyl-4-propan-2-yl-3-pyridinyl)silane |
| SMILES | CC(C)c1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1cc(-c2ccccc2)c2sc3c[c-]c(-c4cc(CC(C)(C)C)ccn4)cc3c2c1.[Ir] |
| InChI | InChI=1S/C29H26NS.C17H22NSi.Ir/c1-19-14-23(21-8-6-5-7-9-21)28-25(15-19)24-17-22(10-11-27(24)31-28)26-16-20(12-13-30-26)18-29(2,3)4;1-13(2)15-11-16(14-9-7-6-8-10-14)18-12-17(15)19(3,4)5;/h5-9,11-17H,18H2,1-4H3;6-9,11-13H,1-5H3;/q2*-1; |
| InChIKey | RJKIKYKSMAVBNI-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.27 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|