C48H44IrN2SSi-2 — CID 166578613
4-(2-deuterio-3-methylbutan-2-yl)-2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[6-(4-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane (PubChem CID 166578613) has the molecular formula C48H44IrN2SSi-2 and a molecular weight of 902.27 g/mol. Its IUPAC name is 4-(2-deuterio-3-methylbutan-2-yl)-2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[6-(4-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane.
| Compound Name | 4-(2-deuterio-3-methylbutan-2-yl)-2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[6-(4-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane |
|---|---|
| PubChem CID | 166578613 |
| Molecular Formula | C48H44IrN2SSi-2 |
| Molecular Weight | 902.27 g/mol |
| Exact Mass | 902.27 |
| IUPAC Name | 4-(2-deuterio-3-methylbutan-2-yl)-2-(7-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine;iridium;trimethyl-[6-(4-phenylbenzene-6-id-1-yl)-3-pyridinyl]silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cc(-c3ccccc3)cc2)nc1.[2H]C(C)(c1ccnc(-c2[c-]ccc3c2sc2cc(-c4ccccc4)ccc23)c1)C(C)C.[Ir] |
| InChI | InChI=1S/C28H24NS.C20H20NSi.Ir/c1-18(2)19(3)21-14-15-29-26(16-21)25-11-7-10-24-23-13-12-22(17-27(23)30-28(24)25)20-8-5-4-6-9-20;1-22(2,3)19-13-14-20(21-15-19)18-11-9-17(10-12-18)16-7-5-4-6-8-16;/h4-10,12-19H,1-3H3;4-11,13-15H,1-3H3;/q2*-1;/i19D;; |
| InChIKey | BMGWTICHGAWXMC-XYBMBZJXSA-N |
| XLogP | 13.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.27 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|