C41H36GeIrN2O-2 — CID 166578651
iridium;1-(8-phenyl-2H-dibenzofuran-2-id-3-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(6-phenyl-3-pyridinyl)germane (PubChem CID 166578651) has the molecular formula C41H36GeIrN2O-2 and a molecular weight of 837.58 g/mol. Its IUPAC name is iridium;1-(8-phenyl-2H-dibenzofuran-2-id-3-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(6-phenyl-3-pyridinyl)germane.
| Compound Name | iridium;1-(8-phenyl-2H-dibenzofuran-2-id-3-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(6-phenyl-3-pyridinyl)germane |
|---|---|
| PubChem CID | 166578651 |
| Molecular Formula | C41H36GeIrN2O-2 |
| Molecular Weight | 837.58 g/mol |
| Exact Mass | 839.17 |
| IUPAC Name | iridium;1-(8-phenyl-2H-dibenzofuran-2-id-3-yl)-5,6,7,8-tetrahydroisoquinoline;trimethyl-(6-phenyl-3-pyridinyl)germane |
| SMILES | C[Ge](C)(C)c1ccc(-c2[c-]cccc2)nc1.[Ir].[c-]1cc2c(cc1-c1nccc3c1CCCC3)oc1ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C27H20NO.C14H16GeN.Ir/c1-2-6-18(7-3-1)20-11-13-25-24(16-20)23-12-10-21(17-26(23)29-25)27-22-9-5-4-8-19(22)14-15-28-27;1-15(2,3)13-9-10-14(16-11-13)12-7-5-4-6-8-12;/h1-3,6-7,11-17H,4-5,8-9H2;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | XMKOAGNIKDLZBO-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.58 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|