About benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate
benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate (PubChem CID 166579522) has the molecular formula C23H22F2N2O2
and a molecular weight of 396.44 g/mol. Its IUPAC name is benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate.
Molecular Properties
| Compound Name | benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate |
| PubChem CID | 166579522 |
| Molecular Formula | C23H22F2N2O2 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OCc1ccccc1)C1CC=C(c2c[nH]c3c(F)cc(F)cc23)CC1 |
| InChI | InChI=1S/C23H22F2N2O2/c1-27(23(28)29-14-15-5-3-2-4-6-15)18-9-7-16(8-10-18)20-13-26-22-19(20)11-17(24)12-21(22)25/h2-7,11-13,18,26H,8-10,14H2,1H3 |
| InChIKey | VCXKNVHFLRQZIN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate?
The IUPAC name of benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate (CID 166579522) is benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate.
What is the SMILES notation for benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate?
The canonical SMILES for benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate is CN(C(=O)OCc1ccccc1)C1CC=C(c2c[nH]c3c(F)cc(F)cc23)CC1.
What is the InChIKey of benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate?
The InChIKey is VCXKNVHFLRQZIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F2N2O2/c1-27(23(28)29-14-15-5-3-2-4-6-15)18-9-7-16(8-10-18)20-13-26-22-19(20)11-17(24)12-21(22)25/h2-7,11-13,18,26H,8-10,14H2,1H3.
What are the key properties of benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate?
benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate has a molecular weight of 396.44 g/mol, XLogP of 5.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[4-(5,7-difluoro-1H-indol-3-yl)cyclohex-3-en-1-yl]-N-methylcarbamate is sourced from PubChem (CID 166579522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).