C22H23FN8OS — CID 166579859
5-[4-[6-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 166579859) has the molecular formula C22H23FN8OS and a molecular weight of 466.55 g/mol. Its IUPAC name is 5-[4-[6-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-[4-[6-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 166579859 |
| Molecular Formula | C22H23FN8OS |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-[4-[6-[[(1R,2S,3S,5R)-2-fluoro-1-methyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3nnc(C#N)s3)cc2O)nn1)[C@H]1C[C@H]2CCC[C@@](C)(N2)[C@H]1F |
| InChI | InChI=1S/C22H23FN8OS/c1-22-7-3-4-13(26-22)9-15(19(22)23)31(2)17-11-25-20(29-27-17)14-6-5-12(8-16(14)32)21-30-28-18(10-24)33-21/h5-6,8,11,13,15,19,26,32H,3-4,7,9H2,1-2H3/t13-,15+,19+,22-/m1/s1 |
| InChIKey | DZLNLSWLHIDVHK-YHILVRBYSA-N |
| XLogP | 3.08 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |