C22H22FN7OS — CID 166579916
2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile (PubChem CID 166579916) has the molecular formula C22H22FN7OS and a molecular weight of 451.53 g/mol. Its IUPAC name is 2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 166579916 |
| Molecular Formula | C22H22FN7OS |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3ncc(C#N)s3)cc2O)nn1)[C@@H]1C[C@@H]2CCC[C@@H](N2)[C@@H]1F |
| InChI | InChI=1S/C22H22FN7OS/c1-30(17-8-13-3-2-4-16(27-13)20(17)23)19-11-25-21(29-28-19)15-6-5-12(7-18(15)31)22-26-10-14(9-24)32-22/h5-7,10-11,13,16-17,20,27,31H,2-4,8H2,1H3/t13-,16+,17+,20-/m0/s1 |
| InChIKey | QHRAHKOYKMVLCQ-ITSWUFQBSA-N |
| XLogP | 3.30 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |