C22H24FN9O — CID 166579942
5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-2-methyl-1,2,4-triazole-3-carbonitrile (PubChem CID 166579942) has the molecular formula C22H24FN9O and a molecular weight of 449.49 g/mol. Its IUPAC name is 5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-2-methyl-1,2,4-triazole-3-carbonitrile.
| Compound Name | 5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-2-methyl-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 166579942 |
| Molecular Formula | C22H24FN9O |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 5-[4-[6-[[(1S,2R,3S,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-2-methyl-1,2,4-triazole-3-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3nc(C#N)n(C)n3)cc2O)nn1)[C@H]1C[C@H]2CCC[C@H](N2)[C@H]1F |
| InChI | InChI=1S/C22H24FN9O/c1-31(16-9-13-4-3-5-15(26-13)20(16)23)19-11-25-22(29-28-19)14-7-6-12(8-17(14)33)21-27-18(10-24)32(2)30-21/h6-8,11,13,15-16,20,26,33H,3-5,9H2,1-2H3/t13-,15+,16+,20-/m1/s1 |
| InChIKey | PVMIPDXPPWGMEI-WJCADGGCSA-N |
| XLogP | 1.97 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |