C24H26FN7OS — CID 166579972
4-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile (PubChem CID 166579972) has the molecular formula C24H26FN7OS and a molecular weight of 479.59 g/mol. Its IUPAC name is 4-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile.
| Compound Name | 4-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
|---|---|
| PubChem CID | 166579972 |
| Molecular Formula | C24H26FN7OS |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 4-[4-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-2-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3csc(C#N)n3)cc2O)nn1)[C@H]1C[C@]2(C)CCC[C@@](C)(N2)[C@H]1F |
| InChI | InChI=1S/C24H26FN7OS/c1-23-7-4-8-24(2,31-23)21(25)17(10-23)32(3)19-12-27-22(30-29-19)15-6-5-14(9-18(15)33)16-13-34-20(11-26)28-16/h5-6,9,12-13,17,21,31,33H,4,7-8,10H2,1-3H3/t17-,21-,23-,24+/m0/s1 |
| InChIKey | VQYXWFSAANREEF-VQONDCLZSA-N |
| XLogP | 4.08 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |