C21H21N5OS — CID 166580046
6-[6-[[(1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]sulfanyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol (PubChem CID 166580046) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is 6-[6-[[(1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]sulfanyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol.
| Compound Name | 6-[6-[[(1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]sulfanyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 166580046 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 6-[6-[[(1R,5S)-1,5-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-yl]sulfanyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol |
| SMILES | C[C@]12C=C[C@](C)(CC(Sc3cnc(-c4cc5ccncc5cc4O)nn3)C1)N2 |
| InChI | InChI=1S/C21H21N5OS/c1-20-4-5-21(2,26-20)10-15(9-20)28-18-12-23-19(25-24-18)16-7-13-3-6-22-11-14(13)8-17(16)27/h3-8,11-12,15,26-27H,9-10H2,1-2H3/t15?,20-,21+ |
| InChIKey | KCQOICMIWVWABV-ZKSIIRFLSA-N |
| XLogP | 3.72 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|