C12H21N — CID 16658007
(2S,6R)-6-tert-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine (PubChem CID 16658007) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (2S,6R)-6-tert-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine.
| Compound Name | (2S,6R)-6-tert-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 16658007 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (2S,6R)-6-tert-butyl-2-prop-2-enyl-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC[C@H]1CC=C[C@H](C(C)(C)C)N1 |
| InChI | InChI=1S/C12H21N/c1-5-7-10-8-6-9-11(13-10)12(2,3)4/h5-6,9-11,13H,1,7-8H2,2-4H3/t10-,11+/m0/s1 |
| InChIKey | ZYKPVTJOLNQBPX-WDEREUQCSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|