C23H24FN5O — CID 166580135
6-[6-[1-[(1R,2R,3R,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol (PubChem CID 166580135) has the molecular formula C23H24FN5O and a molecular weight of 405.48 g/mol. Its IUPAC name is 6-[6-[1-[(1R,2R,3R,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol.
| Compound Name | 6-[6-[1-[(1R,2R,3R,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 166580135 |
| Molecular Formula | C23H24FN5O |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 6-[6-[1-[(1R,2R,3R,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]ethenyl]-1,2,4-triazin-3-yl]isoquinolin-7-ol |
| SMILES | C=C(c1cnc(-c2cc3ccncc3cc2O)nn1)[C@H]1C[C@]2(C)CC[C@@](C)(N2)[C@@H]1F |
| InChI | InChI=1S/C23H24FN5O/c1-13(17-10-22(2)5-6-23(3,29-22)20(17)24)18-12-26-21(28-27-18)16-8-14-4-7-25-11-15(14)9-19(16)30/h4,7-9,11-12,17,20,29-30H,1,5-6,10H2,2-3H3/t17-,20-,22+,23-/m1/s1 |
| InChIKey | JEHZUTNZGQNHLK-ZZNFJVAJSA-N |
| XLogP | 4.06 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |