C21H20FN7OS — CID 166580256
2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile (PubChem CID 166580256) has the molecular formula C21H20FN7OS and a molecular weight of 437.50 g/mol. Its IUPAC name is 2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile.
| Compound Name | 2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
|---|---|
| PubChem CID | 166580256 |
| Molecular Formula | C21H20FN7OS |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-[4-[6-[[(1R,2S,3R,5S)-2-fluoro-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1,3-thiazole-5-carbonitrile |
| SMILES | CN(c1cnc(-c2ccc(-c3ncc(C#N)s3)cc2O)nn1)[C@@H]1C[C@@H]2CC[C@@H](N2)[C@@H]1F |
| InChI | InChI=1S/C21H20FN7OS/c1-29(16-7-12-3-5-15(26-12)19(16)22)18-10-24-20(28-27-18)14-4-2-11(6-17(14)30)21-25-9-13(8-23)31-21/h2,4,6,9-10,12,15-16,19,26,30H,3,5,7H2,1H3/t12-,15+,16+,19-/m0/s1 |
| InChIKey | VGMLWFJPCDGJHH-GJZVTGKDSA-N |
| XLogP | 2.91 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |