C24H26F2N6O2 — CID 166580367
5-fluoro-4-[4-[6-[[(1R,2S,3R,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one (PubChem CID 166580367) has the molecular formula C24H26F2N6O2 and a molecular weight of 468.51 g/mol. Its IUPAC name is 5-fluoro-4-[4-[6-[[(1R,2S,3R,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one.
| Compound Name | 5-fluoro-4-[4-[6-[[(1R,2S,3R,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 166580367 |
| Molecular Formula | C24H26F2N6O2 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 5-fluoro-4-[4-[6-[[(1R,2S,3R,5R)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]-methylamino]-1,2,4-triazin-3-yl]-3-hydroxyphenyl]-1-methylpyridin-2-one |
| SMILES | CN(c1cnc(-c2ccc(-c3cc(=O)n(C)cc3F)cc2O)nn1)[C@@H]1C[C@H]2CCC[C@@H](N2)[C@@H]1F |
| InChI | InChI=1S/C24H26F2N6O2/c1-31-12-17(25)16(10-22(31)34)13-6-7-15(20(33)8-13)24-27-11-21(29-30-24)32(2)19-9-14-4-3-5-18(28-14)23(19)26/h6-8,10-12,14,18-19,23,28,33H,3-5,9H2,1-2H3/t14-,18-,19-,23+/m1/s1 |
| InChIKey | IRKHPKZPOFUEQB-ISPUEKSMSA-N |
| XLogP | 2.81 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |