C26H31FN6O3 — CID 166580466
5-(5,6-dimethoxy-3-pyridinyl)-2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol (PubChem CID 166580466) has the molecular formula C26H31FN6O3 and a molecular weight of 494.57 g/mol. Its IUPAC name is 5-(5,6-dimethoxy-3-pyridinyl)-2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol.
| Compound Name | 5-(5,6-dimethoxy-3-pyridinyl)-2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol |
|---|---|
| PubChem CID | 166580466 |
| Molecular Formula | C26H31FN6O3 |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 5-(5,6-dimethoxy-3-pyridinyl)-2-[6-[[(1R,2S,3S,5S)-2-fluoro-1,5-dimethyl-8-azabicyclo[3.2.1]octan-3-yl]-methylamino]-1,2,4-triazin-3-yl]phenol |
| SMILES | COc1cc(-c2ccc(-c3ncc(N(C)[C@H]4C[C@]5(C)CC[C@@](C)(N5)[C@H]4F)nn3)c(O)c2)cnc1OC |
| InChI | InChI=1S/C26H31FN6O3/c1-25-8-9-26(2,32-25)22(27)18(12-25)33(3)21-14-28-23(31-30-21)17-7-6-15(10-19(17)34)16-11-20(35-4)24(36-5)29-13-16/h6-7,10-11,13-14,18,22,32,34H,8-9,12H2,1-5H3/t18-,22-,25-,26+/m0/s1 |
| InChIKey | YHDISYMKBHFYFH-FEOIUFSTSA-N |
| XLogP | 3.77 |
| TPSA | 105.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |