C24H30FN9O — CID 166580707
2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2-methyltetrazol-5-yl)phenol (PubChem CID 166580707) has the molecular formula C24H30FN9O and a molecular weight of 479.56 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2-methyltetrazol-5-yl)phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2-methyltetrazol-5-yl)phenol |
|---|---|
| PubChem CID | 166580707 |
| Molecular Formula | C24H30FN9O |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,2R,3R,5R)-2-fluoro-1,5-dimethyl-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-(2-methyltetrazol-5-yl)phenol |
| SMILES | Cn1nnc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@@]5(C)CCC[C@](C)(N5)[C@@H]4F)nn3)c(O)c2)n1 |
| InChI | InChI=1S/C24H30FN9O/c1-23-9-4-10-24(2,31-23)20(25)17(12-23)34(15-6-7-15)19-13-26-22(28-27-19)16-8-5-14(11-18(16)35)21-29-32-33(3)30-21/h5,8,11,13,15,17,20,31,35H,4,6-7,9-10,12H2,1-3H3/t17-,20-,23-,24+/m1/s1 |
| InChIKey | IHTQSQSLFJSLRA-POWYHZRHSA-N |
| XLogP | 2.80 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |