C26H28F2N6OS — CID 166580710
2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol (PubChem CID 166580710) has the molecular formula C26H28F2N6OS and a molecular weight of 513.63 g/mol. Its IUPAC name is 2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol.
| Compound Name | 2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol |
|---|---|
| PubChem CID | 166580710 |
| Molecular Formula | C26H28F2N6OS |
| Molecular Weight | 513.63 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 2-[6-[cyclopropyl-[(1S,2S,3R,5S)-2-fluoro-9-azabicyclo[3.3.1]nonan-3-yl]amino]-1,2,4-triazin-3-yl]-5-[5-fluoro-2-(trideuteriomethylsulfanyl)-4-pyridinyl]phenol |
| SMILES | [2H]C([2H])([2H])Sc1cc(-c2ccc(-c3ncc(N(C4CC4)[C@@H]4C[C@@H]5CCC[C@H](N5)[C@@H]4F)nn3)c(O)c2)c(F)cn1 |
| InChI | InChI=1S/C26H28F2N6OS/c1-36-24-11-18(19(27)12-29-24)14-5-8-17(22(35)9-14)26-30-13-23(32-33-26)34(16-6-7-16)21-10-15-3-2-4-20(31-15)25(21)28/h5,8-9,11-13,15-16,20-21,25,31,35H,2-4,6-7,10H2,1H3/t15-,20-,21+,25-/m0/s1/i1D3 |
| InChIKey | JOVTZZSQLMQYPU-GTXVJMBJSA-N |
| XLogP | 4.76 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |