About 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide
4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 16658122) has the molecular formula C16H12N2OS
and a molecular weight of 280.35 g/mol. Its IUPAC name is 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 16658122 |
| Molecular Formula | C16H12N2OS |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1scnc1-c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C16H12N2OS/c17-16(19)15-14(18-10-20-15)13-8-4-7-12(9-13)11-5-2-1-3-6-11/h1-10H,(H2,17,19) |
| InChIKey | ZUBURHAQYILJPT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide (CID 16658122) is 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide is NC(=O)c1scnc1-c1cccc(-c2ccccc2)c1.
What is the InChIKey of 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide?
The InChIKey is ZUBURHAQYILJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2OS/c17-16(19)15-14(18-10-20-15)13-8-4-7-12(9-13)11-5-2-1-3-6-11/h1-10H,(H2,17,19).
What are the key properties of 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide?
4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide has a molecular weight of 280.35 g/mol, XLogP of 3.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenylphenyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 16658122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).