C54H38N2 — CID 166581716
N-[4-[3-(2-carbazol-9-ylphenyl)phenyl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline (PubChem CID 166581716) has the molecular formula C54H38N2 and a molecular weight of 726.99 g/mol. Its IUPAC name is N-[4-[3-(2-carbazol-9-ylphenyl)phenyl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline.
| Compound Name | N-[4-[3-(2-carbazol-9-ylphenyl)phenyl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 166581716 |
| Molecular Formula | C54H38N2 |
| Molecular Weight | 726.99 g/mol |
| Exact Mass | 726.38 |
| IUPAC Name | N-[4-[3-(2-carbazol-9-ylphenyl)phenyl]-2,3,5,6-tetradeuteriophenyl]-2,3,5,6-tetradeuterio-4-phenyl-N-(2,3,5,6-tetradeuterio-4-phenylphenyl)aniline |
| SMILES | [2H]c1c([2H])c(N(c2c([2H])c([2H])c(-c3ccccc3)c([2H])c2[2H])c2c([2H])c([2H])c(-c3cccc(-c4ccccc4-n4c5ccccc5c5ccccc54)c3)c([2H])c2[2H])c([2H])c([2H])c1-c1ccccc1 |
| InChI | InChI=1S/C54H38N2/c1-3-14-39(15-4-1)41-26-32-46(33-27-41)55(47-34-28-42(29-35-47)40-16-5-2-6-17-40)48-36-30-43(31-37-48)44-18-13-19-45(38-44)49-20-7-10-23-52(49)56-53-24-11-8-21-50(53)51-22-9-12-25-54(51)56/h1-38H/i26D,27D,28D,29D,30D,31D,32D,33D,34D,35D,36D,37D |
| InChIKey | HIBQFRZQRZODER-FLOCFFOOSA-N |
| XLogP | 14.92 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.99 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |