About N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide
N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide (PubChem CID 16658264) has the molecular formula C18H16F3NO2
and a molecular weight of 335.32 g/mol. Its IUPAC name is N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide.
Molecular Properties
| Compound Name | N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide |
| PubChem CID | 16658264 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide |
| SMILES | CC(C(=O)c1ccccc1)N(Cc1ccccc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C18H16F3NO2/c1-13(16(23)15-10-6-3-7-11-15)22(17(24)18(19,20)21)12-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3 |
| InChIKey | QSMMTXSHEGGILI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide?
The IUPAC name of N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide (CID 16658264) is N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide.
What is the SMILES notation for N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide?
The canonical SMILES for N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide is CC(C(=O)c1ccccc1)N(Cc1ccccc1)C(=O)C(F)(F)F.
What is the InChIKey of N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide?
The InChIKey is QSMMTXSHEGGILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO2/c1-13(16(23)15-10-6-3-7-11-15)22(17(24)18(19,20)21)12-14-8-4-2-5-9-14/h2-11,13H,12H2,1H3.
What are the key properties of N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide?
N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide has a molecular weight of 335.32 g/mol, XLogP of 3.85, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2,2,2-trifluoro-N-(1-oxo-1-phenylpropan-2-yl)acetamide is sourced from PubChem (CID 16658264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).