About CID 16658373
CID 16658373 (PubChem CID 16658373) has the molecular formula C18H22FeO+2
and a molecular weight of 310.22 g/mol.
Molecular Properties
| Compound Name | CID 16658373 |
| PubChem CID | 16658373 |
| Molecular Formula | C18H22FeO+2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | — |
| SMILES | C[C@@](O)([C]1[CH][CH][CH][CH]1)[C@H]1C=CCCC1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C13H17O.C5H5.Fe/c1-13(14,12-9-5-6-10-12)11-7-3-2-4-8-11;1-2-4-5-3-1;/h3,5-7,9-11,14H,2,4,8H2,1H3;1-5H;/q;;+2/t11-,13-;;/m0../s1 |
| InChIKey | YKYRJSPHBFSKHV-JBUFHSOLSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 16658373 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16658373?
The IUPAC name of CID 16658373 (CID 16658373) is not available.
What is the SMILES notation for CID 16658373?
The canonical SMILES for CID 16658373 is C[C@@](O)([C]1[CH][CH][CH][CH]1)[C@H]1C=CCCC1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 16658373?
The InChIKey is YKYRJSPHBFSKHV-JBUFHSOLSA-N. The full InChI is InChI=1S/C13H17O.C5H5.Fe/c1-13(14,12-9-5-6-10-12)11-7-3-2-4-8-11;1-2-4-5-3-1;/h3,5-7,9-11,14H,2,4,8H2,1H3;1-5H;/q;;+2/t11-,13-;;/m0../s1.
What are the key properties of CID 16658373?
CID 16658373 has a molecular weight of 310.22 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16658373 is sourced from PubChem (CID 16658373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).