C31H27N3O8 — CID 16658406
dimethyl (1S,2R,3S,5R,6S,7R,8S,12R)-10-[2-(acridine-4-carbonylamino)ethyl]-9,11-dioxo-4-oxa-10-azapentacyclo[5.5.1.02,6.03,5.08,12]tridecane-3,5-dicarboxylate (PubChem CID 16658406) has the molecular formula C31H27N3O8 and a molecular weight of 569.57 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,5R,6S,7R,8S,12R)-10-[2-(acridine-4-carbonylamino)ethyl]-9,11-dioxo-4-oxa-10-azapentacyclo[5.5.1.02,6.03,5.08,12]tridecane-3,5-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,5R,6S,7R,8S,12R)-10-[2-(acridine-4-carbonylamino)ethyl]-9,11-dioxo-4-oxa-10-azapentacyclo[5.5.1.02,6.03,5.08,12]tridecane-3,5-dicarboxylate |
|---|---|
| PubChem CID | 16658406 |
| Molecular Formula | C31H27N3O8 |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | dimethyl (1S,2R,3S,5R,6S,7R,8S,12R)-10-[2-(acridine-4-carbonylamino)ethyl]-9,11-dioxo-4-oxa-10-azapentacyclo[5.5.1.02,6.03,5.08,12]tridecane-3,5-dicarboxylate |
| SMILES | COC(=O)[C@]12O[C@@]1(C(=O)OC)[C@@H]1[C@@H]3C[C@@H]([C@@H]4C(=O)N(CCNC(=O)c5cccc6cc7ccccc7nc56)C(=O)[C@H]34)[C@@H]12 |
| InChI | InChI=1S/C31H27N3O8/c1-40-28(38)30-22-17-13-18(23(22)31(30,42-30)29(39)41-2)21-20(17)26(36)34(27(21)37)11-10-32-25(35)16-8-5-7-15-12-14-6-3-4-9-19(14)33-24(15)16/h3-9,12,17-18,20-23H,10-11,13H2,1-2H3,(H,32,35)/t17-,18+,20-,21+,22-,23+,30-,31+ |
| InChIKey | FLDIDZJHHHATHM-CTNIYYABSA-N |
| XLogP | 1.47 |
| TPSA | 144.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|