C57H42N4 — CID 166584354
17-[4-[4,6-bis(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene (PubChem CID 166584354) has the molecular formula C57H42N4 and a molecular weight of 782.99 g/mol. Its IUPAC name is 17-[4-[4,6-bis(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene.
| Compound Name | 17-[4-[4,6-bis(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 166584354 |
| Molecular Formula | C57H42N4 |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.34 |
| IUPAC Name | 17-[4-[4,6-bis(3,5-dimethylphenyl)pyrimidin-2-yl]phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(21),2(10),3,5,7,11,13,15,17,19-decaene |
| SMILES | Cc1cc(C)cc(-c2cc(-c3cc(C)cc(C)c3)nc(-c3ccc(-c4cccc5c4nc(-c4ccccc4)c4ccc6c(c7ccccc7n6-c6ccccc6)c45)cc3)n2)c1 |
| InChI | InChI=1S/C57H42N4/c1-35-28-36(2)31-42(30-35)49-34-50(43-32-37(3)29-38(4)33-43)59-57(58-49)41-24-22-39(23-25-41)45-19-13-20-47-53-48(55(60-56(45)47)40-14-7-5-8-15-40)26-27-52-54(53)46-18-11-12-21-51(46)61(52)44-16-9-6-10-17-44/h5-34H,1-4H3 |
| InChIKey | OUSMFZQXGPUKNF-UHFFFAOYSA-N |
| XLogP | 14.84 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|