C52H33N5 — CID 166584665
18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3,5,7,11,14,16(21),17,19-decaene (PubChem CID 166584665) has the molecular formula C52H33N5 and a molecular weight of 727.87 g/mol. Its IUPAC name is 18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3,5,7,11,14,16(21),17,19-decaene.
| Compound Name | 18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3,5,7,11,14,16(21),17,19-decaene |
|---|---|
| PubChem CID | 166584665 |
| Molecular Formula | C52H33N5 |
| Molecular Weight | 727.87 g/mol |
| Exact Mass | 727.27 |
| IUPAC Name | 18-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,14-diphenyl-9,15-diazapentacyclo[11.8.0.02,10.03,8.016,21]henicosa-1(13),2(10),3,5,7,11,14,16(21),17,19-decaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(c4)nc(-c4ccccc4)c4ccc6c(c7ccccc7n6-c6ccccc6)c45)cc3)n2)cc1 |
| InChI | InChI=1S/C52H33N5/c1-5-15-35(16-6-1)49-43-31-32-46-48(42-23-13-14-24-45(42)57(46)40-21-11-4-12-22-40)47(43)41-30-29-39(33-44(41)53-49)34-25-27-38(28-26-34)52-55-50(36-17-7-2-8-18-36)54-51(56-52)37-19-9-3-10-20-37/h1-33H |
| InChIKey | LOKOQHVGRUOIOU-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.87 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|