About 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate
2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate (PubChem CID 166585852) has the molecular formula C21H21F3N2O3
and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate.
Molecular Properties
| Compound Name | 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate |
| PubChem CID | 166585852 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate |
| SMILES | CCOCCNC(=O)OCCc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C21H21F3N2O3/c1-2-28-10-8-25-21(27)29-9-7-16-17-11-15(23)12-18(24)20(17)26-19(16)13-3-5-14(22)6-4-13/h3-6,11-12,26H,2,7-10H2,1H3,(H,25,27) |
| InChIKey | ADNKTCDZMJPIBM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate?
The IUPAC name of 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate (CID 166585852) is 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate.
What is the SMILES notation for 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate?
The canonical SMILES for 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate is CCOCCNC(=O)OCCc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12.
What is the InChIKey of 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate?
The InChIKey is ADNKTCDZMJPIBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3N2O3/c1-2-28-10-8-25-21(27)29-9-7-16-17-11-15(23)12-18(24)20(17)26-19(16)13-3-5-14(22)6-4-13/h3-6,11-12,26H,2,7-10H2,1H3,(H,25,27).
What are the key properties of 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate?
2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate has a molecular weight of 406.40 g/mol, XLogP of 4.56, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]ethyl N-(2-ethoxyethyl)carbamate is sourced from PubChem (CID 166585852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).