About 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine
3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine (PubChem CID 166586021) has the molecular formula C17H13F5N2
and a molecular weight of 340.30 g/mol. Its IUPAC name is 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine.
Molecular Properties
| Compound Name | 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine |
| PubChem CID | 166586021 |
| Molecular Formula | C17H13F5N2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine |
| SMILES | NCC(F)(F)Cc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12 |
| InChI | InChI=1S/C17H13F5N2/c18-10-3-1-9(2-4-10)15-13(7-17(21,22)8-23)12-5-11(19)6-14(20)16(12)24-15/h1-6,24H,7-8,23H2 |
| InChIKey | RBPOIIQOAXWKNJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine?
The IUPAC name of 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine (CID 166586021) is 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine.
What is the SMILES notation for 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine?
The canonical SMILES for 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine is NCC(F)(F)Cc1c(-c2ccc(F)cc2)[nH]c2c(F)cc(F)cc12.
What is the InChIKey of 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine?
The InChIKey is RBPOIIQOAXWKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F5N2/c18-10-3-1-9(2-4-10)15-13(7-17(21,22)8-23)12-5-11(19)6-14(20)16(12)24-15/h1-6,24H,7-8,23H2.
What are the key properties of 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine?
3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine has a molecular weight of 340.30 g/mol, XLogP of 4.39, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5,7-difluoro-2-(4-fluorophenyl)-1H-indol-3-yl]-2,2-difluoropropan-1-amine is sourced from PubChem (CID 166586021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).