C12H21ClFN3 — CID 166586154
3-(4-chloro-3-fluorocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine (PubChem CID 166586154) has the molecular formula C12H21ClFN3 and a molecular weight of 261.77 g/mol. Its IUPAC name is 3-(4-chloro-3-fluorocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine.
| Compound Name | 3-(4-chloro-3-fluorocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 166586154 |
| Molecular Formula | C12H21ClFN3 |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3-(4-chloro-3-fluorocyclohexyl)-1,2,3,5,6,7,8,8a-octahydroimidazo[1,2-a]pyrazine |
| SMILES | FC1CC(C2CNC3CNCCN32)CCC1Cl |
| InChI | InChI=1S/C12H21ClFN3/c13-9-2-1-8(5-10(9)14)11-6-16-12-7-15-3-4-17(11)12/h8-12,15-16H,1-7H2 |
| InChIKey | HKALOMXJSOALGW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|