C16H21BN2O4 — CID 166586259
7-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (PubChem CID 166586259) has the molecular formula C16H21BN2O4 and a molecular weight of 316.17 g/mol. Its IUPAC name is 7-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline.
| Compound Name | 7-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
|---|---|
| PubChem CID | 166586259 |
| Molecular Formula | C16H21BN2O4 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 7-(methoxymethoxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
| SMILES | COCOc1cc2ncncc2cc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H21BN2O4/c1-15(2)16(3,4)23-17(22-15)12-6-11-8-18-9-19-13(11)7-14(12)21-10-20-5/h6-9H,10H2,1-5H3 |
| InChIKey | CUUSQCUMNBVGSE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|