About 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide
6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide (PubChem CID 166586500) has the molecular formula C14H17NO3
and a molecular weight of 247.29 g/mol. Its IUPAC name is 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide |
| PubChem CID | 166586500 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide |
| SMILES | CC(C)c1cc2cc(C(=O)N(C)C)oc2cc1O |
| InChI | InChI=1S/C14H17NO3/c1-8(2)10-5-9-6-13(14(17)15(3)4)18-12(9)7-11(10)16/h5-8,16H,1-4H3 |
| InChIKey | WMKWKTCJNMNCGO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide?
The IUPAC name of 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide (CID 166586500) is 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide.
What is the SMILES notation for 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide?
The canonical SMILES for 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide is CC(C)c1cc2cc(C(=O)N(C)C)oc2cc1O.
What is the InChIKey of 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide?
The InChIKey is WMKWKTCJNMNCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO3/c1-8(2)10-5-9-6-13(14(17)15(3)4)18-12(9)7-11(10)16/h5-8,16H,1-4H3.
What are the key properties of 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide?
6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide has a molecular weight of 247.29 g/mol, XLogP of 2.96, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-N,N-dimethyl-5-propan-2-yl-1-benzofuran-2-carboxamide is sourced from PubChem (CID 166586500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).