C20H20FN7O — CID 166586797
2-[6-[[(1R,2S,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol (PubChem CID 166586797) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is 2-[6-[[(1R,2S,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol.
| Compound Name | 2-[6-[[(1R,2S,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol |
|---|---|
| PubChem CID | 166586797 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[6-[[(1R,2S,3S,5R)-2-fluoro-8-azabicyclo[3.2.1]oct-6-en-3-yl]-methylamino]pyridazin-3-yl]-5-(triazol-1-yl)phenol |
| SMILES | CN(c1ccc(-c2ccc(-n3ccnn3)cc2O)nn1)[C@H]1C[C@@H]2C=C[C@@H](N2)[C@@H]1F |
| InChI | InChI=1S/C20H20FN7O/c1-27(17-10-12-2-5-16(23-12)20(17)21)19-7-6-15(24-25-19)14-4-3-13(11-18(14)29)28-9-8-22-26-28/h2-9,11-12,16-17,20,23,29H,10H2,1H3/t12-,16+,17-,20-/m0/s1 |
| InChIKey | FDKOCFYGKKIKKC-RGZWXSTOSA-N |
| XLogP | 1.87 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|