C17H19F2S+ — CID 16658699
difluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium (PubChem CID 16658699) has the molecular formula C17H19F2S+ and a molecular weight of 293.40 g/mol. Its IUPAC name is difluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium.
| Compound Name | difluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
|---|---|
| PubChem CID | 16658699 |
| Molecular Formula | C17H19F2S+ |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | difluoromethyl-phenyl-(2,3,4,5-tetramethylphenyl)sulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)C(F)F)c(C)c(C)c1C |
| InChI | InChI=1S/C17H19F2S/c1-11-10-16(14(4)13(3)12(11)2)20(17(18)19)15-8-6-5-7-9-15/h5-10,17H,1-4H3/q+1 |
| InChIKey | OSHDHIDSJRDPJS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|