C12H13BrFN3O4S — CID 166587158
(2R,4S,5R)-4-azido-2-(5-bromo-2-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol (PubChem CID 166587158) has the molecular formula C12H13BrFN3O4S and a molecular weight of 394.22 g/mol. Its IUPAC name is (2R,4S,5R)-4-azido-2-(5-bromo-2-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol.
| Compound Name | (2R,4S,5R)-4-azido-2-(5-bromo-2-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 166587158 |
| Molecular Formula | C12H13BrFN3O4S |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | (2R,4S,5R)-4-azido-2-(5-bromo-2-fluorophenyl)sulfanyl-6-(hydroxymethyl)oxane-3,5-diol |
| SMILES | [N-]=[N+]=N[C@@H]1C(O)[C@@H](Sc2cc(Br)ccc2F)OC(CO)[C@@H]1O |
| InChI | InChI=1S/C12H13BrFN3O4S/c13-5-1-2-6(14)8(3-5)22-12-11(20)9(16-17-15)10(19)7(4-18)21-12/h1-3,7,9-12,18-20H,4H2/t7?,9-,10-,11?,12+/m0/s1 |
| InChIKey | DTHNDEQHHNLOJM-SCBPDFROSA-N |
| XLogP | 1.80 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|