C38H65NO6 — CID 166587338
[10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]propanoate (PubChem CID 166587338) has the molecular formula C38H65NO6 and a molecular weight of 631.94 g/mol. Its IUPAC name is [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]propanoate.
| Compound Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 166587338 |
| Molecular Formula | C38H65NO6 |
| Molecular Weight | 631.94 g/mol |
| Exact Mass | 631.48 |
| IUPAC Name | [10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3-[2-[2-[3-(methylamino)-3-oxopropoxy]ethoxy]ethoxy]propanoate |
| SMILES | CNC(=O)CCOCCOCCOCCC(=O)OC1CCC2(C)C(=CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C38H65NO6/c1-27(2)8-7-9-28(3)32-12-13-33-31-11-10-29-26-30(14-18-37(29,4)34(31)15-19-38(32,33)5)45-36(41)17-21-43-23-25-44-24-22-42-20-16-35(40)39-6/h10,27-28,30-34H,7-9,11-26H2,1-6H3,(H,39,40) |
| InChIKey | DEZLJCPZEYWAOC-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.94 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|