About 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide
4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 16658826) has the molecular formula C17H12N2O2S
and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide |
| PubChem CID | 16658826 |
| Molecular Formula | C17H12N2O2S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1scnc1-c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C17H12N2O2S/c18-17(21)16-14(19-10-22-16)12-7-4-8-13(9-12)15(20)11-5-2-1-3-6-11/h1-10H,(H2,18,21) |
| InChIKey | WHIUTTDGNRPWQW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide (CID 16658826) is 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide is NC(=O)c1scnc1-c1cccc(C(=O)c2ccccc2)c1.
What is the InChIKey of 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide?
The InChIKey is WHIUTTDGNRPWQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O2S/c18-17(21)16-14(19-10-22-16)12-7-4-8-13(9-12)15(20)11-5-2-1-3-6-11/h1-10H,(H2,18,21).
What are the key properties of 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide?
4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide has a molecular weight of 308.36 g/mol, XLogP of 3.14, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-benzoylphenyl)-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 16658826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).