About 4-phenyl-1,3-thiazole-5-carboxamide
4-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 16658827) has the molecular formula C10H8N2OS
and a molecular weight of 204.25 g/mol. Its IUPAC name is 4-phenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-phenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 16658827 |
| Molecular Formula | C10H8N2OS |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.04 |
| IUPAC Name | 4-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1scnc1-c1ccccc1 |
| InChI | InChI=1S/C10H8N2OS/c11-10(13)9-8(12-6-14-9)7-4-2-1-3-5-7/h1-6H,(H2,11,13) |
| InChIKey | ZLKBOBCOZBUZSF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-phenyl-1,3-thiazole-5-carboxamide (CID 16658827) is 4-phenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-phenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-phenyl-1,3-thiazole-5-carboxamide is NC(=O)c1scnc1-c1ccccc1.
What is the InChIKey of 4-phenyl-1,3-thiazole-5-carboxamide?
The InChIKey is ZLKBOBCOZBUZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2OS/c11-10(13)9-8(12-6-14-9)7-4-2-1-3-5-7/h1-6H,(H2,11,13).
What are the key properties of 4-phenyl-1,3-thiazole-5-carboxamide?
4-phenyl-1,3-thiazole-5-carboxamide has a molecular weight of 204.25 g/mol, XLogP of 1.91, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 16658827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).