About N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide
N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide (PubChem CID 16658830) has the molecular formula C34H37N3O2
and a molecular weight of 519.69 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide.
Molecular Properties
| Compound Name | N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide |
| PubChem CID | 16658830 |
| Molecular Formula | C34H37N3O2 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.29 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide |
| SMILES | NC(=O)CN(CCC(c1ccccc1)c1ccccc1)C(=O)CNCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37N3O2/c35-33(38)26-37(24-22-32(29-17-9-3-10-18-29)30-19-11-4-12-20-30)34(39)25-36-23-21-31(27-13-5-1-6-14-27)28-15-7-2-8-16-28/h1-20,31-32,36H,21-26H2,(H2,35,38) |
| InChIKey | RBFFTSAHMSYLAK-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide?
The IUPAC name of N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide (CID 16658830) is N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide.
What is the SMILES notation for N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide?
The canonical SMILES for N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide is NC(=O)CN(CCC(c1ccccc1)c1ccccc1)C(=O)CNCCC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide?
The InChIKey is RBFFTSAHMSYLAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H37N3O2/c35-33(38)26-37(24-22-32(29-17-9-3-10-18-29)30-19-11-4-12-20-30)34(39)25-36-23-21-31(27-13-5-1-6-14-27)28-15-7-2-8-16-28/h1-20,31-32,36H,21-26H2,(H2,35,38).
What are the key properties of N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide?
N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide has a molecular weight of 519.69 g/mol, XLogP of 5.33, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-oxoethyl)-N-(3,3-diphenylpropyl)-2-(3,3-diphenylpropylamino)acetamide is sourced from PubChem (CID 16658830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).