About 2-diazenylbutane-1,4-dithiol
2-diazenylbutane-1,4-dithiol (PubChem CID 166589969) has the molecular formula C4H10N2S2
and a molecular weight of 150.27 g/mol. Its IUPAC name is 2-diazenylbutane-1,4-dithiol.
Molecular Properties
| Compound Name | 2-diazenylbutane-1,4-dithiol |
| PubChem CID | 166589969 |
| Molecular Formula | C4H10N2S2 |
| Molecular Weight | 150.27 g/mol |
| Exact Mass | 150.03 |
| IUPAC Name | 2-diazenylbutane-1,4-dithiol |
| SMILES | [H]/N=N/C(CS)CCS |
| InChI | InChI=1S/C4H10N2S2/c5-6-4(3-8)1-2-7/h4-5,7-8H,1-3H2/b6-5+ |
| InChIKey | PIMUKVVKPCAAFA-AATRIKPKSA-N |
| XLogP | 1.64 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenylbutane-1,4-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenylbutane-1,4-dithiol?
The IUPAC name of 2-diazenylbutane-1,4-dithiol (CID 166589969) is 2-diazenylbutane-1,4-dithiol.
What is the SMILES notation for 2-diazenylbutane-1,4-dithiol?
The canonical SMILES for 2-diazenylbutane-1,4-dithiol is [H]/N=N/C(CS)CCS.
What is the InChIKey of 2-diazenylbutane-1,4-dithiol?
The InChIKey is PIMUKVVKPCAAFA-AATRIKPKSA-N. The full InChI is InChI=1S/C4H10N2S2/c5-6-4(3-8)1-2-7/h4-5,7-8H,1-3H2/b6-5+.
What are the key properties of 2-diazenylbutane-1,4-dithiol?
2-diazenylbutane-1,4-dithiol has a molecular weight of 150.27 g/mol, XLogP of 1.64, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenylbutane-1,4-dithiol is sourced from PubChem (CID 166589969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).