C32H35O9S2+ — CID 166590257
bis(3,4-dimethoxyphenyl)-[2-(3,4-dimethoxyphenyl)sulfinyl-4,5-dimethoxyphenyl]sulfanium (PubChem CID 166590257) has the molecular formula C32H35O9S2+ and a molecular weight of 627.76 g/mol. Its IUPAC name is bis(3,4-dimethoxyphenyl)-[2-(3,4-dimethoxyphenyl)sulfinyl-4,5-dimethoxyphenyl]sulfanium.
| Compound Name | bis(3,4-dimethoxyphenyl)-[2-(3,4-dimethoxyphenyl)sulfinyl-4,5-dimethoxyphenyl]sulfanium |
|---|---|
| PubChem CID | 166590257 |
| Molecular Formula | C32H35O9S2+ |
| Molecular Weight | 627.76 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | bis(3,4-dimethoxyphenyl)-[2-(3,4-dimethoxyphenyl)sulfinyl-4,5-dimethoxyphenyl]sulfanium |
| SMILES | COc1ccc(S(=O)c2cc(OC)c(OC)cc2[S+](c2ccc(OC)c(OC)c2)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C32H35O9S2/c1-34-23-12-9-20(15-26(23)37-4)42(21-10-13-24(35-2)27(16-21)38-5)31-18-29(40-7)30(41-8)19-32(31)43(33)22-11-14-25(36-3)28(17-22)39-6/h9-19H,1-8H3/q+1 |
| InChIKey | ILVYHYDPNRQISI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|