C20H25N3O2S — CID 166590415
2-[(2-butyl-1-benzothiophen-3-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 166590415) has the molecular formula C20H25N3O2S and a molecular weight of 371.51 g/mol. Its IUPAC name is 2-[(2-butyl-1-benzothiophen-3-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | 2-[(2-butyl-1-benzothiophen-3-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 166590415 |
| Molecular Formula | C20H25N3O2S |
| Molecular Weight | 371.51 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-[(2-butyl-1-benzothiophen-3-yl)methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CCCCc1sc2ccccc2c1CN1CCN2C(=O)CNC(=O)C2C1 |
| InChI | InChI=1S/C20H25N3O2S/c1-2-3-7-18-15(14-6-4-5-8-17(14)26-18)12-22-9-10-23-16(13-22)20(25)21-11-19(23)24/h4-6,8,16H,2-3,7,9-13H2,1H3,(H,21,25) |
| InChIKey | KWELGQIKJRYJBF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |