C20H22ClFN4O — CID 166590565
1-[(3R)-azepan-3-yl]-7-chloro-3-(2-fluoro-6-methylphenyl)-4H-pyrido[4,3-d]pyrimidin-2-one (PubChem CID 166590565) has the molecular formula C20H22ClFN4O and a molecular weight of 388.87 g/mol. Its IUPAC name is 1-[(3R)-azepan-3-yl]-7-chloro-3-(2-fluoro-6-methylphenyl)-4H-pyrido[4,3-d]pyrimidin-2-one.
| Compound Name | 1-[(3R)-azepan-3-yl]-7-chloro-3-(2-fluoro-6-methylphenyl)-4H-pyrido[4,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 166590565 |
| Molecular Formula | C20H22ClFN4O |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-[(3R)-azepan-3-yl]-7-chloro-3-(2-fluoro-6-methylphenyl)-4H-pyrido[4,3-d]pyrimidin-2-one |
| SMILES | Cc1cccc(F)c1N1Cc2cnc(Cl)cc2N([C@@H]2CCCCNC2)C1=O |
| InChI | InChI=1S/C20H22ClFN4O/c1-13-5-4-7-16(22)19(13)25-12-14-10-24-18(21)9-17(14)26(20(25)27)15-6-2-3-8-23-11-15/h4-5,7,9-10,15,23H,2-3,6,8,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | RTEDPFKJEKZPMQ-OAHLLOKOSA-N |
| XLogP | 4.27 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|