C21H38BNO7 — CID 166590741
CID 166590741 (PubChem CID 166590741) has the molecular formula C21H38BNO7 and a molecular weight of 427.35 g/mol.
| Compound Name | CID 166590741 |
|---|---|
| PubChem CID | 166590741 |
| Molecular Formula | C21H38BNO7 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(C)C)[C@H](OC(C)C)C1OCCNC(=O)COC(=O)CCCCC |
| InChI | InChI=1S/C21H38BNO7/c1-6-7-8-9-18(25)28-13-17(24)23-10-11-26-20-19(29-15(4)5)16(30-21(20)22)12-27-14(2)3/h14-16,19-21H,6-13H2,1-5H3,(H,23,24)/t16-,19+,20?,21-/m1/s1 |
| InChIKey | BFIOIFCNXSDFFE-XBBZPSQXSA-N |
| XLogP | 1.72 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|