C9H14ClN3O4S — CID 166591524
3-pyrrolidin-3-yl-1-sulfamoylpyrrole-2-carboxylic acid;hydrochloride (PubChem CID 166591524) has the molecular formula C9H14ClN3O4S and a molecular weight of 295.75 g/mol. Its IUPAC name is 3-pyrrolidin-3-yl-1-sulfamoylpyrrole-2-carboxylic acid;hydrochloride.
| Compound Name | 3-pyrrolidin-3-yl-1-sulfamoylpyrrole-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 166591524 |
| Molecular Formula | C9H14ClN3O4S |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-pyrrolidin-3-yl-1-sulfamoylpyrrole-2-carboxylic acid;hydrochloride |
| SMILES | Cl.NS(=O)(=O)n1ccc(C2CCNC2)c1C(=O)O |
| InChI | InChI=1S/C9H13N3O4S.ClH/c10-17(15,16)12-4-2-7(8(12)9(13)14)6-1-3-11-5-6;/h2,4,6,11H,1,3,5H2,(H,13,14)(H2,10,15,16);1H |
| InChIKey | ZGIQAZYCRCLYKE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |