About 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one
5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one (PubChem CID 166591924) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one |
| PubChem CID | 166591924 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one |
| SMILES | CCN1CCC(C)(C)[C@@H](Oc2ccc3c(c2)COC3=O)C1 |
| InChI | InChI=1S/C17H23NO3/c1-4-18-8-7-17(2,3)15(10-18)21-13-5-6-14-12(9-13)11-20-16(14)19/h5-6,9,15H,4,7-8,10-11H2,1-3H3/t15-/m0/s1 |
| InChIKey | SLJJLLWUDRLIOI-HNNXBMFYSA-N |
| XLogP | 2.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one?
The IUPAC name of 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one (CID 166591924) is 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one.
What is the SMILES notation for 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one?
The canonical SMILES for 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one is CCN1CCC(C)(C)[C@@H](Oc2ccc3c(c2)COC3=O)C1.
What is the InChIKey of 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one?
The InChIKey is SLJJLLWUDRLIOI-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-4-18-8-7-17(2,3)15(10-18)21-13-5-6-14-12(9-13)11-20-16(14)19/h5-6,9,15H,4,7-8,10-11H2,1-3H3/t15-/m0/s1.
What are the key properties of 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one?
5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one has a molecular weight of 289.38 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3R)-1-ethyl-4,4-dimethylpiperidin-3-yl]oxy-3H-2-benzofuran-1-one is sourced from PubChem (CID 166591924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).